Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1296 | Purity: >98% |
 | |
| Chemical structure of XMD8-87 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | ACK1-B19 |
|---|---|
| CAS No. | 1234480-46-6 |
| Purity | >98% |
| Formula | C24H27N7O2 |
| Mol Weight | 445.5169 |
| CoA | CoA of XMD8-87 |
| Smiles: | COC1=CC(=CC=C1NC1=NC2=C(NC(=O)C3=C(C=CC=C3)N2C)C=N1)N1CCN(C)CC1 |
|---|
KEYWORDS: buy XMD8-87 | XMD8-87 supplier | purchase | cost | manufacturer | order | distributor | buy 1234480-46-6 | 1234480-46-6 supplier