Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A237 | Purity: >98% |
 | |
| Chemical structure of XL019 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 945755-56-6 |
|---|---|
| Purity | >98% |
| Formula | C25H28N6O2 |
| Mol Weight | 444.5288 |
| CoA | CoA of XL019 |
| Smiles: | O=C(NC1=CC=C(C=C1)C1=NC(NC2=CC=C(C=C2)N2CCOCC2)=NC=C1)[C@@H]1CCCN1 |
|---|
KEYWORDS: buy XL019 | XL019 supplier | purchase | cost | manufacturer | order | distributor | buy 945755-56-6 | 945755-56-6 supplier