Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1708 | Purity: >98% |
 | |
| Chemical structure of XCT790 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 725247-18-7 |
|---|---|
| Purity | >98% |
| Formula | C23H13F9N4O3S |
| Mol Weight | 596.425 |
| CoA | CoA of XCT790 |
| Smiles: | COC1=C(OCC2=C(C=C(C=C2)C(F)(F)F)C(F)(F)F)C=CC(\C=C(/C#N)C(=O)NC2=NN=C(S2)C(F)(F)F)=C1 |
|---|
KEYWORDS: buy XCT790 | XCT790 supplier | purchase | cost | manufacturer | order | distributor | buy 725247-18-7 | 725247-18-7 supplier