Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2258 | Purity: >99% |
 | |
| Chemical structure of WY-14643 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Pirinixic Acid |
|---|---|
| CAS No. | 50892-23-4 |
| Purity | >99% |
| Formula | C14H14ClN3O2S |
| Mol Weight | 323.798 |
| CoA | CoA of WY-14643 |
| Smiles: | CC1=C(C)C(NC2=CC(Cl)=NC(SCC(O)=O)=N2)=CC=C1 |
|---|
KEYWORDS: buy WY-14643 | WY-14643 supplier | purchase | cost | manufacturer | order | distributor | buy 50892-23-4 | 50892-23-4 supplier