Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3495 | Purity: >98% |
 | |
| Chemical structure of WWL 154 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | WWL-154 |
|---|---|
| CAS No. | 1338574-93-8 |
| Purity | >98% |
| Formula | C18H19N3O5 |
| Mol Weight | 357.3606 |
| CoA | CoA of WWL 154 |
| Smiles: | O=C(N1CCN(C2=CC=C(OC)C=C2)CC1)OC3=CC=C([N+]([O-])=O)C=C3 |
|---|
KEYWORDS: buy WWL 154 | WWL 154 supplier | purchase | cost | manufacturer | order | distributor | buy 1338574-93-8 | 1338574-93-8 supplier