Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3530 | Purity: >98% |
 | |
| Chemical structure of WST-5 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 178925-55-8 |
|---|---|
| Purity | >98% |
| Formula | C52H44N12Na2O16S6 |
| Mol Weight | 1331.346 |
| CoA | CoA of WST-5 |
| Smiles: | COC1=C(C=CC(=C1)C2=CC(=C(C=C2)[N+]3=NC(=NN3C4=NC5=CC=CC=C5S4)C6=CC=C(C=C6)C(=O)N(CCS(=O)(=O)[O-])CCS(=O)(=O)[O-])OC)[N+]7=NC(=NN7C8=NC9=CC=CC=C9S8)C1=CC=C(C=C1)C(=O)N(CCS(=O)(=O)[O-])CCS(=O)(=O)[O-].[Na+].[Na+] |
|---|
KEYWORDS: buy WST-5 | WST-5 supplier | purchase | cost | manufacturer | order | distributor | buy 178925-55-8 | 178925-55-8 supplier