Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3528 | Purity: >98% |
 | |
| Chemical structure of WST-1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 150849-52-8 |
|---|---|
| Purity | >98% |
| Formula | C19H11IN5NaO8S2 |
| Mol Weight | 651.344 |
| CoA | CoA of WST-1 |
| Smiles: | C1=CC(=CC=C1N2N=C(N=[N+]2C3=CC=C(C=C3)[N+](=O)[O-])C4=C(C=C(C=C4)S(=O)(=O)[O-])S(=O)(=O)[O-])I.[Na+] |
|---|
KEYWORDS: buy WST-1 | WST-1 supplier | purchase | cost | manufacturer | order | distributor | buy 150849-52-8 | 150849-52-8 supplier