Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2181 | Purity: >98% |
 | |
| Chemical structure of WS3 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1421227-52-2 |
|---|---|
| Purity | >98% |
| Formula | C28H30F3N7O3 |
| Mol Weight | 569.5781 |
| CoA | CoA of WS3 |
| Smiles: | CN1CCN(CC2=CC=C(NC(=O)NC3=CC=C(OC4=CC(NC(=O)C5CC5)=NC=N4)C=C3)C=C2C(F)(F)F)CC1 |
|---|
KEYWORDS: buy WS3 | WS3 supplier | purchase | cost | manufacturer | order | distributor | buy 1421227-52-2 | 1421227-52-2 supplier