Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3496 | Purity: >98% |
 | |
| Chemical structure of WS 383 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2247544-02-9 |
|---|---|
| Purity | >98% |
| Formula | C18H21Cl2N9S2 |
| Mol Weight | 498.456 |
| CoA | CoA of WS 383 hydrochloride |
| Smiles: | CN(C)CCN1N=NN=C1SC2=CC(C)=NC3=NC(SCC4=CC=C(Cl)C=C4)=NN23.Cl |
|---|
KEYWORDS: buy WS 383 hydrochloride | WS 383 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 2247544-02-9 | 2247544-02-9 supplier