Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4053 | Purity: >98% |
 | |
| Chemical structure of WRG-28 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1913291-02-7 |
|---|---|
| Purity | >98% |
| Formula | C21H18N2O5S |
| Mol Weight | 410.443 |
| CoA | CoA of WRG-28 |
| Smiles: | O=S(C1=CC=C(COC2=CC(OC3=CC(C=CC3=N4)=O)=C4C=C2)C=C1)(NCC)=O |
|---|
KEYWORDS: buy WRG-28 | WRG-28 supplier | purchase | cost | manufacturer | order | distributor | buy 1913291-02-7 | 1913291-02-7 supplier