Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2484 | Purity: >98% |
 | |
| Chemical structure of WEHI-345 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1354825-58-3 |
|---|---|
| Purity | >98% |
| Formula | C22H23N7O |
| Mol Weight | 401.4643 |
| CoA | CoA of WEHI-345 |
| Smiles: | CC1=CC=C(C=C1)C1=NN(C2=NC=NC(N)=C12)C(C)(C)CNC(=O)C1=CC=NC=C1 |
|---|
KEYWORDS: buy WEHI-345 | WEHI-345 supplier | purchase | cost | manufacturer | order | distributor | buy 1354825-58-3 | 1354825-58-3 supplier