Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1883 | Purity: >98% |
 | |
| Chemical structure of WAY316606 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | WAY-316606 |
|---|---|
| CAS No. | 915759-45-4 |
| Purity | >98% |
| Formula | C18H19F3N2O4S2 |
| Mol Weight | 448.48 |
| CoA | CoA of WAY316606 |
| Smiles: | FC(F)(F)C1=CC=C(C=C1S(=O)(=O)NC1CCNCC1)S(=O)(=O)C1=CC=CC=C1 |
|---|
KEYWORDS: buy WAY316606 | WAY316606 supplier | purchase | cost | manufacturer | order | distributor | buy 915759-45-4 | 915759-45-4 supplier