Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16999 | Purity: >98% |
 | |
| Chemical structure of WAY-658876 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 863558-02-5 |
|---|---|
| Purity | >98% |
| Formula | C25H25FN4O3 |
| Mol Weight | 448.4894 |
| CoA | CoA of WAY-658876 |
| Smiles: | FC1C=CC(=CC=1)N1CCN(CC1)C(C1C=NC=CC=1)CNC(C1=CC=C2C(=C1)OCO2)=O |
|---|
KEYWORDS: buy WAY-658876 | WAY-658876 supplier | purchase | cost | manufacturer | order | distributor | buy 863558-02-5 | 863558-02-5 supplier