Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9648P | Purity: >98% |
 | |
| Chemical structure of WAY-359440 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 438031-72-2 |
|---|---|
| Purity | >98% |
| Formula | C17H17N3O3 |
| Mol Weight | 311.3352 |
| CoA | CoA of WAY-359440 |
| Smiles: | COC1=CC=C(OCC(=O)NCC2=NC3=CC=CC=C3N2)C=C1 |
|---|
KEYWORDS: buy WAY-359440 | WAY-359440 supplier | purchase | cost | manufacturer | order | distributor | buy 438031-72-2 | 438031-72-2 supplier