Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A7842T | Purity: >98% |
 | |
| Chemical structure of WAY-332076 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1015865-34-5 |
|---|---|
| Purity | >98% |
| Formula | C20H18ClFN2O3S |
| Mol Weight | 420.885 |
| CoA | CoA of WAY-332076 |
| Smiles: | CC1=C(N=C(O1)C2=CC=CC=C2Cl)CS(=O)CC(=O)NCC3=CC=C(C=C3)F |
|---|
KEYWORDS: buy WAY-332076 | WAY-332076 supplier | purchase | cost | manufacturer | order | distributor | buy 1015865-34-5 | 1015865-34-5 supplier