Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A17001 | Purity: >98% |
 | |
| Chemical structure of WAY-325855 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 868357-74-8 |
|---|---|
| Purity | >98% |
| Formula | C22H17ClN4O2S |
| Mol Weight | 436.914 |
| CoA | CoA of WAY-325855 |
| Smiles: | CC1=C(C#N)C2=NC3=CC=CC=C3N2C(SCC(NC4=C(OC)C=CC(Cl)=C4)=O)=C1 |
|---|
KEYWORDS: buy WAY-325855 | WAY-325855 supplier | purchase | cost | manufacturer | order | distributor | buy 868357-74-8 | 868357-74-8 supplier