Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1570 | Purity: >98% |
 | |
| Chemical structure of VX-11e |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 896720-20-0 |
|---|---|
| Purity | >98% |
| Formula | C24H20Cl2FN5O2 |
| Mol Weight | 500.352 |
| CoA | CoA of VX-11e |
| Smiles: | CC1=C(N=C(NC2=C(Cl)C=C(F)C=C2)N=C1)C1=CNC(=C1)C(=O)N[C@H](CO)C1=CC=CC(Cl)=C1 |
|---|
KEYWORDS: buy VX-11e | VX-11e supplier | purchase | cost | manufacturer | order | distributor | buy 896720-20-0 | 896720-20-0 supplier