Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4036 | Purity: >98% |
 | |
| Chemical structure of VU0238441 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 85511-68-8 |
|---|---|
| Purity | >98% |
| Formula | C16H9ClF3NO2 |
| Mol Weight | 339.696 |
| CoA | CoA of VU0238441 |
| Smiles: | C1=CC2=C(C(=C1)Cl)N(C(=O)C2=O)CC3=CC=C(C=C3)C(F)(F)F |
|---|
KEYWORDS: buy VU0238441 | VU0238441 supplier | purchase | cost | manufacturer | order | distributor | buy 85511-68-8 | 85511-68-8 supplier