Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4042 | Purity: >98% |
 | |
| Chemical structure of VU0238429 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1160247-92-6 |
|---|---|
| Purity | >98% |
| Formula | C17H12F3NO4 |
| Mol Weight | 351.2767 |
| CoA | CoA of VU0238429 |
| Smiles: | O=C1N(CC2=CC=C(OC)C=C2)C3=C(C=C(OC(F)(F)F)C=C3)C1=O |
|---|
KEYWORDS: buy VU0238429 | VU0238429 supplier | purchase | cost | manufacturer | order | distributor | buy 1160247-92-6 | 1160247-92-6 supplier