Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1104 | Purity: >98% |
 | |
| Chemical structure of VR23 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1624602-30-7 |
|---|---|
| Purity | >98% |
| Formula | C19H16ClN5O6S |
| Mol Weight | 477.878 |
| CoA | CoA of VR23 |
| Smiles: | [O-][N+](=O)C1=CC=C(C(=C1)[N+]([O-])=O)S(=O)(=O)N1CCN(CC1)C1=CC=NC2=CC(Cl)=CC=C12 |
|---|
KEYWORDS: buy VR23 | VR23 supplier | purchase | cost | manufacturer | order | distributor | buy 1624602-30-7 | 1624602-30-7 supplier