Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2348 | Purity: >98% |
 | |
| Chemical structure of Vortioxetine hydrobromide |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 960203-27-4 |
|---|---|
| Purity | >98% |
| Formula | C18H23BrN2S |
| Mol Weight | 379.358 |
| CoA | CoA of Vortioxetine hydrobromide |
| Smiles: | Br.CC1=CC=C(SC2=CC=CC=C2N2CCNCC2)C(C)=C1 |
|---|
KEYWORDS: buy Vortioxetine hydrobromide | Vortioxetine hydrobromide supplier | purchase | cost | manufacturer | order | distributor | buy 960203-27-4 | 960203-27-4 supplier