Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A847 | Purity: >98% |
 | |
| Chemical structure of Voreloxin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | SNS-595 |
|---|---|
| Synonyms 2 | AG 7352 |
| CAS No. | 175414-77-4 |
| Purity | >98% |
| Formula | C18H19N5O4S |
| Mol Weight | 401.44 |
| CoA | CoA of Voreloxin |
| Smiles: | CN[C@H]1CN(C[C@@H]1OC)C1=NC2=C(C=C1)C(=O)C(=CN2C1=NC=CS1)C(O)=O |
|---|
KEYWORDS: buy Voreloxin | Voreloxin supplier | purchase | cost | manufacturer | order | distributor | buy 175414-77-4 | 175414-77-4 supplier