Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2177 | Purity: >98% |
 | |
| Chemical structure of Vilanterol |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | GW642444X |
|---|---|
| Synonyms 2 | GW642444 |
| CAS No. | 503068-34-6 |
| Purity | >98% |
| Formula | C24H33Cl2NO5 |
| Mol Weight | 486.429 |
| CoA | CoA of Vilanterol |
| Smiles: | OCC1=CC(=CC=C1O)[C@@H](O)CNCCCCCCOCCOCC1=C(Cl)C=CC=C1Cl |
|---|
KEYWORDS: buy Vilanterol | Vilanterol supplier | purchase | cost | manufacturer | order | distributor | buy 503068-34-6 | 503068-34-6 supplier