Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3928 | Purity: >98% |
 | |
| Chemical structure of VH032-PEG3-acetylene |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2098799-80-3 |
|---|---|
| Purity | >98% |
| Formula | C31H42N4O7S |
| Mol Weight | 614.753 |
| CoA | CoA of VH032-PEG3-acetylene |
| Smiles: | O=C(NCC1=CC=C(C2=C(C)N=CS2)C=C1)[C@H]3N(C([C@H](C(C)(C)C)NC(COCCOCCOCC#C)=O)=O)C[C@H](O)C3 |
|---|
KEYWORDS: buy VH032-PEG3-acetylene | VH032-PEG3-acetylene supplier | purchase | cost | manufacturer | order | distributor | buy 2098799-80-3 | 2098799-80-3 supplier