Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3937 | Purity: >97% |
 | |
| Chemical structure of VH032-C4-NH2 dihydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | (S,R,S)-AHPC-C4-NH2 dihydrochloride |
|---|---|
| CAS No. | 2341796-78-7 |
| Purity | >97% |
| Formula | C27H41Cl2N5O4S |
| Mol Weight | 602.617 |
| CoA | CoA of VH032-C4-NH2 dihydrochloride |
| Smiles: | O=C(NCC1=CC=C(C2=C(C)N=CS2)C=C1)[C@H]3N(C([C@H](C(C)(C)C)NC(CCCCN)=O)=O)C[C@H](O)C3.Cl.Cl |
|---|
KEYWORDS: buy VH032-C4-NH2 dihydrochloride | VH032-C4-NH2 dihydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 2341796-78-7 | 2341796-78-7 supplier