Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A15590 | Purity: >98% |
 | |
| Chemical structure of Verbenone |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 18309-32-5 |
|---|---|
| Purity | >98% |
| Formula | C10H14O |
| Mol Weight | 150.2176 |
| CoA | CoA of Verbenone |
| Smiles: | CC1=CC(=O)[C@@H]2C[C@H]1C2(C)C |
|---|
KEYWORDS: buy Verbenone | Verbenone supplier | purchase | cost | manufacturer | order | distributor | buy 18309-32-5 | 18309-32-5 supplier