Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3785 | Purity: >98% |
 | |
| Chemical structure of VER-246608 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1684386-71-7 |
|---|---|
| Purity | >98% |
| Formula | C28H23ClF2N4O4 |
| Mol Weight | 552.956 |
| CoA | CoA of VER-246608 |
| Smiles: | O=C(C1=CC=C(O)C=C1O)N(CC2=CC=C(CNC(C(F)F)=O)C=C2)C(C=C3)=CC=C3C4=NC(Cl)=NC=C4C |
|---|
KEYWORDS: buy VER-246608 | VER-246608 supplier | purchase | cost | manufacturer | order | distributor | buy 1684386-71-7 | 1684386-71-7 supplier