Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2965 | Purity: >98% |
 | |
| Chemical structure of V-9302 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1855871-76-9 |
|---|---|
| Purity | >98% |
| Formula | C34H38N2O4 |
| Mol Weight | 538.6765 |
| CoA | CoA of V-9302 |
| Smiles: | CC1=CC(COC2=CC=CC=C2CN(CC[C@H](N)C(O)=O)CC2=CC=CC=C2OCC2=CC=CC(C)=C2)=CC=C1 |
|---|
KEYWORDS: buy V-9302 | V-9302 supplier | purchase | cost | manufacturer | order | distributor | buy 1855871-76-9 | 1855871-76-9 supplier