Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1228 | Purity: >98% |
 | |
| Chemical structure of URB602 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 565460-15-3 |
|---|---|
| Purity | >98% |
| Formula | C19H21NO2 |
| Mol Weight | 295.3755 |
| CoA | CoA of URB602 |
| Smiles: | O=C(NC1=CC=CC(=C1)C1=CC=CC=C1)OC1CCCCC1 |
|---|
KEYWORDS: buy URB602 | URB602 supplier | purchase | cost | manufacturer | order | distributor | buy 565460-15-3 | 565460-15-3 supplier