Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2347 | Purity: >98% |
 | |
| Chemical structure of UNC1079 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1418741-86-2 |
|---|---|
| Purity | >98% |
| Formula | C28H42N4O2 |
| Mol Weight | 466.6587 |
| CoA | CoA of UNC1079 |
| Smiles: | O=C(N1CCC(CC1)N1CCCCC1)C1=CC=C(C=C1)C(=O)N1CCC(CC1)N1CCCCC1 |
|---|
KEYWORDS: buy UNC1079 | UNC1079 supplier | purchase | cost | manufacturer | order | distributor | buy 1418741-86-2 | 1418741-86-2 supplier