Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3593 | Purity: >98% |
 | |
| Chemical structure of Umirolimus |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Biolimus A9 |
|---|---|
| Synonyms 2 | 42-O-(2-ethoxyethyl) rapamycin |
| CAS No. | 851536-75-9 |
| Purity | >98% |
| Formula | C55H87NO14 |
| Mol Weight | 986.2776 |
| CoA | CoA of Umirolimus |
| Smiles: | CCOCCO[C@@H]1CC[C@H](C[C@H]1OC)C[C@@H](C)[C@@H]2CC(=O)[C@@H](/C=C(/[C@H]([C@H](C(=O)[C@@H](C[C@@H](/C=C/C=C/C=C(/[C@H](C[C@@H]3CC[C@H]([C@@](O3)(C(=O)C(=O)N4CCCC[C@H]4C(=O)O2)O)C)OC)\C)C)C)OC)O)\C)C |
|---|
KEYWORDS: buy Umirolimus | Umirolimus supplier | purchase | cost | manufacturer | order | distributor | buy 851536-75-9 | 851536-75-9 supplier