Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A762 | Purity: >98% |
 | |
| Chemical structure of UMI-77 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 518303-20-3 |
|---|---|
| Purity | >98% |
| Formula | C18H14BrNO5S2 |
| Mol Weight | 468.341 |
| CoA | CoA of UMI-77 |
| Smiles: | OC(=O)CSC1=CC(NS(=O)(=O)C2=CC=C(Br)C=C2)=C2C=CC=CC2=C1O |
|---|
KEYWORDS: buy UMI-77 | UMI-77 supplier | purchase | cost | manufacturer | order | distributor | buy 518303-20-3 | 518303-20-3 supplier