Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1882 | Purity: >98% |
 | |
| Chemical structure of UM-164 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 903564-48-7 |
|---|---|
| Purity | >98% |
| Formula | C30H31F3N8O3S |
| Mol Weight | 640.679 |
| CoA | CoA of UM-164 |
| Smiles: | CC1=NC(=CC(NC2=NC=C(S2)C(=O)NC2=CC(NC(=O)C3=CC=CC(=C3)C(F)(F)F)=CC=C2C)=N1)N1CCN(CCO)CC1 |
|---|
KEYWORDS: buy UM-164 | UM-164 supplier | purchase | cost | manufacturer | order | distributor | buy 903564-48-7 | 903564-48-7 supplier