Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A17075 | Purity: >98% |
 | |
| Chemical structure of UAMC-4821 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3094522-02-5 |
|---|---|
| Purity | >98% |
| Formula | C15H19N3O |
| Mol Weight | 257.3309 |
| CoA | CoA of UAMC-4821 |
| Smiles: | N1=COC(=C1)C=2C=CC(NC3CCCCC3)=C(N)C2 |
|---|
KEYWORDS: buy UAMC-4821 | UAMC-4821 supplier | purchase | cost | manufacturer | order | distributor | buy 3094522-02-5 | 3094522-02-5 supplier