Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3052 | Purity: >98% |
 | |
| Chemical structure of UAMC-3203 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2271358-65-5 |
|---|---|
| Purity | >98% |
| Formula | C25H38ClN5O2S |
| Mol Weight | 508.12 |
| CoA | CoA of UAMC-3203 hydrochloride |
| Smiles: | O=S(C(C=C1NCC2=CC=CC=C2)=CC=C1NC3CCCCC3)(NCCN4CCNCC4)=O.Cl |
|---|
KEYWORDS: buy UAMC-3203 hydrochloride | UAMC-3203 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 2271358-65-5 | 2271358-65-5 supplier