Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16429H | Purity: >97% |
 | |
| Chemical structure of TXPhos |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | 2,6-bis(2,4,6-triisopropylphenyl)phenyl-dicyclohexylphosphine |
|---|---|
| CAS No. | 2376379-81-4 |
| Purity | >97% |
| Formula | C48H71P |
| Mol Weight | 679.0511 |
| CoA | CoA of TXPhos |
| Smiles: | C1=CC(C2=C(C=C(C=C2C(C)C)C(C)C)C(C)C)=C(C(=C1)C=3C(=CC(=CC3C(C)C)C(C)C)C(C)C)P(C4CCCCC4)C5CCCCC5 |
|---|
KEYWORDS: buy TXPhos | TXPhos supplier | purchase | cost | manufacturer | order | distributor | buy 2376379-81-4 | 2376379-81-4 supplier