Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3643 | Purity: >98% |
 | |
| Chemical structure of TVB-2640 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | FASN-IN-2 |
|---|---|
| CAS No. | 1399177-37-7 |
| Purity | >98% |
| Formula | C27H29N5O |
| Mol Weight | 439.5521 |
| CoA | CoA of TVB-2640 |
| Smiles: | N#CC1=CC=C(C2CCN(C(C3=CC(C4=NC(C)=NN4)=C(C5CCC5)C=C3C)=O)CC2)C=C1 |
|---|
KEYWORDS: buy TVB-2640 | TVB-2640 supplier | purchase | cost | manufacturer | order | distributor | buy 1399177-37-7 | 1399177-37-7 supplier