Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A243 | Purity: >98% |
 | |
| Chemical structure of Tulathromycin A |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 217500-96-4 |
|---|---|
| Purity | >98% |
| Formula | C41H79N3O12 |
| Mol Weight | 806.0789 |
| CoA | CoA of Tulathromycin A |
| Smiles: | [H][C@@]1(C[C@@](C)(OC)[C@](O)(CNCCC)[C@H](C)O1)O[C@H]1[C@H](C)[C@@H](O[C@]2([H])O[C@H](C)C[C@@H]([C@H]2O)N(C)C)[C@](C)(O)C[C@@H](C)CN[C@H](C)[C@@H](O)[C@](C)(O)[C@@H](CC)OC(=O)[C@@H]1C |
|---|
KEYWORDS: buy Tulathromycin A | Tulathromycin A supplier | purchase | cost | manufacturer | order | distributor | buy 217500-96-4 | 217500-96-4 supplier