Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16430D | Purity: >97% |
 | |
| Chemical structure of TTPhos |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3106694-36-1 |
|---|---|
| Purity | >97% |
| Formula | C36H47P |
| Mol Weight | 510.7321 |
| CoA | CoA of TTPhos |
| Smiles: | C1=CC(C2=C(C=C(C=C2C)C)C)=C(C(=C1)C=3C(=CC(=CC3C)C)C)P(C4CCCCC4)C5CCCCC5 |
|---|
KEYWORDS: buy TTPhos | TTPhos supplier | purchase | cost | manufacturer | order | distributor | buy 3106694-36-1 | 3106694-36-1 supplier