Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1703 | Purity: >98% |
 | |
| Chemical structure of TTA-A2 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 953778-63-7 |
|---|---|
| Purity | >98% |
| Formula | C20H21F3N2O2 |
| Mol Weight | 378.3881 |
| CoA | CoA of TTA-A2 |
| Smiles: | C[C@@H](NC(=O)CC1=CC=C(C=C1)C1CC1)C1=NC=C(OCC(F)(F)F)C=C1 |
|---|
KEYWORDS: buy TTA-A2 | TTA-A2 supplier | purchase | cost | manufacturer | order | distributor | buy 953778-63-7 | 953778-63-7 supplier