Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A14985 | Purity: >99.5% |
 | |
| Chemical structure of Tryptophanol |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Tryptophanol |
|---|---|
| CAS No. | 2899-29-8 |
| Purity | >99.5% |
| Formula | C11H14N2O |
| Mol Weight | 190.2417 |
| CoA | CoA of Tryptophanol |
| Smiles: | C1=CC=C2C(=C1)C(=CN2)C[C@@H](CO)N |
|---|
KEYWORDS: buy Tryptophanol | Tryptophanol supplier | purchase | cost | manufacturer | order | distributor | buy 2899-29-8 | 2899-29-8 supplier