Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3735 | Purity: >98% |
 | |
| Chemical structure of TRi-1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | TRi-1 |
|---|---|
| Synonyms 2 | TXNRD1 inhibitor 1 |
| CAS No. | 246020-68-8 |
| Purity | >98% |
| Formula | C12H9ClN2O5S |
| Mol Weight | 328.728 |
| CoA | CoA of TRi-1 |
| Smiles: | O=[N+](C1=CC=C(OC)N=C1S(=O)(C2=CC=C(Cl)C=C2)=O)[O-] |
|---|
KEYWORDS: buy TRi-1 | TRi-1 supplier | purchase | cost | manufacturer | order | distributor | buy 246020-68-8 | 246020-68-8 supplier