Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1772 | Purity: >98% |
 | |
| Chemical structure of Travoprost |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 157283-68-6 |
|---|---|
| Purity | >98% |
| Formula | C26H35F3O6 |
| Mol Weight | 500.5477 |
| CoA | CoA of Travoprost |
| Smiles: | CC(C)OC(=O)CCC\C=C/C[C@H]1[C@@H](O)C[C@@H](O)[C@@H]1\C=C\[C@@H](O)COC1=CC=CC(=C1)C(F)(F)F |
|---|
KEYWORDS: buy Travoprost | Travoprost supplier | purchase | cost | manufacturer | order | distributor | buy 157283-68-6 | 157283-68-6 supplier