Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2939 | Purity: >98% |
 | |
| Chemical structure of Trans-Clomiphene citrate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Enclomiphene citrate |
|---|---|
| CAS No. | 7599-79-3 |
| Purity | >98% |
| Formula | C32H36ClNO8 |
| Mol Weight | 598.083 |
| CoA | CoA of Trans-Clomiphene citrate |
| Smiles: | OC(=O)CC(O)(CC(O)=O)C(O)=O.CCN(CC)CCOC1=CC=C(C=C1)C(=C(\Cl)C1=CC=CC=C1)\C1=CC=CC=C1 |
|---|
KEYWORDS: buy Trans-Clomiphene citrate | Trans-Clomiphene citrate supplier | purchase | cost | manufacturer | order | distributor | buy 7599-79-3 | 7599-79-3 supplier