Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12319 | Purity: >98% |
 | |
| Chemical structure of Trabectedin intermediate A23 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 366020-68-0 |
|---|---|
| Purity | >98% |
| Formula | C31H34N4O8S |
| Mol Weight | 622.689 |
| CoA | CoA of Trabectedin intermediate A23 |
| Smiles: | CCC1=C2C(=C3C4COC(=O)C(CSC(C3=C1OC(=O)C)C5N4C(C6CC7=C(C5N6CC)C(=C(C(=C7)C)OC)O)C#C)N)OCO2 |
|---|
KEYWORDS: buy Trabectedin intermediate A23 | Trabectedin intermediate A23 supplier | purchase | cost | manufacturer | order | distributor | buy 366020-68-0 | 366020-68-0 supplier