Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A647 | Purity: >98% |
 | |
| Chemical structure of TPT-260 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 769856-81-7 |
|---|---|
| Purity | >98% |
| Formula | C8H12N4S3 |
| Mol Weight | 260.403 |
| CoA | CoA of TPT-260 |
| Smiles: | NC(=N)SCC1=CC=C(CSC(N)=N)S1 |
|---|
KEYWORDS: buy TPT-260 | TPT-260 supplier | purchase | cost | manufacturer | order | distributor | buy 769856-81-7 | 769856-81-7 supplier