Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A834 | Purity: >98% |
 | |
| Chemical structure of Topotecan |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 123948-87-8 |
|---|---|
| Purity | >98% |
| Formula | C23H23N3O5 |
| Mol Weight | 421.4458 |
| CoA | CoA of Topotecan |
| Smiles: | CC[C@@]1(O)C(=O)OCC2=C1C=C1N(CC3=C1N=C1C=CC(O)=C(CN(C)C)C1=C3)C2=O |
|---|
KEYWORDS: buy Topotecan | Topotecan supplier | purchase | cost | manufacturer | order | distributor | buy 123948-87-8 | 123948-87-8 supplier