Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A448 | Purity: >98% |
 | |
| Chemical structure of Tomeglovir |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 233254-24-5 |
|---|---|
| Purity | >98% |
| Formula | C23H27N3O4S |
| Mol Weight | 441.543 |
| CoA | CoA of Tomeglovir |
| Smiles: | CN(C)C1=CC=CC2=C(C=CC=C12)S(=O)(=O)NC1=CC=C(NC(=O)C(C)(C)CO)C=C1 |
|---|
KEYWORDS: buy Tomeglovir | Tomeglovir supplier | purchase | cost | manufacturer | order | distributor | buy 233254-24-5 | 233254-24-5 supplier