Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2571 | Purity: >98% |
 | |
| Chemical structure of TMP195 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1314891-22-9 |
|---|---|
| Purity | >98% |
| Formula | C23H19F3N4O3 |
| Mol Weight | 456.4172 |
| CoA | CoA of TMP195 |
| Smiles: | CC(C)(CNC(=O)C1=CC(=CC=C1)C1=NOC(=N1)C(F)(F)F)C1=COC(=N1)C1=CC=CC=C1 |
|---|
KEYWORDS: buy TMP195 | TMP195 supplier | purchase | cost | manufacturer | order | distributor | buy 1314891-22-9 | 1314891-22-9 supplier