Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2169 | Purity: >98% |
 | |
| Chemical structure of Tivantinib |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | ARQ197 |
|---|---|
| CAS No. | 905854-02-6 |
| Purity | >98% |
| Formula | C23H19N3O2 |
| Mol Weight | 369.4159 |
| CoA | CoA of Tivantinib |
| Smiles: | O=C1NC(=O)[C@H]([C@@H]1C1=CNC2=C1C=CC=C2)C1=CN2CCCC3=C2C1=CC=C3 |
|---|
KEYWORDS: buy Tivantinib | Tivantinib supplier | purchase | cost | manufacturer | order | distributor | buy 905854-02-6 | 905854-02-6 supplier